C16H19BrINO4S — CID 129077166
tert-butyl 5-bromo-1-(2-iodosulfanylethoxymethyl)-3-oxo-1H-isoindole-2-carboxylate (PubChem CID 129077166) has the molecular formula C16H19BrINO4S and a molecular weight of 528.21 g/mol. Its IUPAC name is tert-butyl 5-bromo-1-(2-iodosulfanylethoxymethyl)-3-oxo-1H-isoindole-2-carboxylate.
| Compound Name | tert-butyl 5-bromo-1-(2-iodosulfanylethoxymethyl)-3-oxo-1H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 129077166 |
| Molecular Formula | C16H19BrINO4S |
| Molecular Weight | 528.21 g/mol |
| Exact Mass | 526.93 |
| IUPAC Name | tert-butyl 5-bromo-1-(2-iodosulfanylethoxymethyl)-3-oxo-1H-isoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)c2cc(Br)ccc2C1COCCSI |
| InChI | InChI=1S/C16H19BrINO4S/c1-16(2,3)23-15(21)19-13(9-22-6-7-24-18)11-5-4-10(17)8-12(11)14(19)20/h4-5,8,13H,6-7,9H2,1-3H3 |
| InChIKey | LUPRNVYQOACMRS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.21 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|