C16H21BrNO4P — CID 171062812
tert-butyl 5-bromo-7-dimethylphosphoryl-1-methyl-3-oxo-1H-isoindole-2-carboxylate (PubChem CID 171062812) has the molecular formula C16H21BrNO4P and a molecular weight of 402.23 g/mol. Its IUPAC name is tert-butyl 5-bromo-7-dimethylphosphoryl-1-methyl-3-oxo-1H-isoindole-2-carboxylate.
| Compound Name | tert-butyl 5-bromo-7-dimethylphosphoryl-1-methyl-3-oxo-1H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 171062812 |
| Molecular Formula | C16H21BrNO4P |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | tert-butyl 5-bromo-7-dimethylphosphoryl-1-methyl-3-oxo-1H-isoindole-2-carboxylate |
| SMILES | CC1c2c(cc(Br)cc2P(C)(C)=O)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21BrNO4P/c1-9-13-11(7-10(17)8-12(13)23(5,6)21)14(19)18(9)15(20)22-16(2,3)4/h7-9H,1-6H3 |
| InChIKey | XWKLLFBPAZAYJT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|