C10H17NO3 — CID 135392142
tert-butyl 2,4-dimethyl-3-oxoazetidine-1-carboxylate (PubChem CID 135392142) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is tert-butyl 2,4-dimethyl-3-oxoazetidine-1-carboxylate.
| Compound Name | tert-butyl 2,4-dimethyl-3-oxoazetidine-1-carboxylate |
|---|---|
| PubChem CID | 135392142 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | tert-butyl 2,4-dimethyl-3-oxoazetidine-1-carboxylate |
| SMILES | CC1C(=O)C(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17NO3/c1-6-8(12)7(2)11(6)9(13)14-10(3,4)5/h6-7H,1-5H3 |
| InChIKey | OHLGSQSWZWUQHA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |