C11H19NO2 — CID 133054170
tert-butyl 2,5-dimethyl-2,5-dihydropyrrole-1-carboxylate (PubChem CID 133054170) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is tert-butyl 2,5-dimethyl-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 2,5-dimethyl-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 133054170 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | tert-butyl 2,5-dimethyl-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC1C=CC(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19NO2/c1-8-6-7-9(2)12(8)10(13)14-11(3,4)5/h6-9H,1-5H3 |
| InChIKey | QABFQTRGKUXCMP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|