C12H23NO2 — CID 144878026
tert-butyl (6R)-2,6-dimethylpiperidine-1-carboxylate (PubChem CID 144878026) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is tert-butyl (6R)-2,6-dimethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (6R)-2,6-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 144878026 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | tert-butyl (6R)-2,6-dimethylpiperidine-1-carboxylate |
| SMILES | CC1CCC[C@@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO2/c1-9-7-6-8-10(2)13(9)11(14)15-12(3,4)5/h9-10H,6-8H2,1-5H3/t9-,10?/m1/s1 |
| InChIKey | XFHDOSGLKQJYLP-YHMJZVADSA-N |
| XLogP | 3.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |