C17H33NO2 — CID 70015662
tert-butyl (6S)-2-methyl-6-(4-methylpentyl)piperidine-1-carboxylate (PubChem CID 70015662) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is tert-butyl (6S)-2-methyl-6-(4-methylpentyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (6S)-2-methyl-6-(4-methylpentyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70015662 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | tert-butyl (6S)-2-methyl-6-(4-methylpentyl)piperidine-1-carboxylate |
| SMILES | CC(C)CCC[C@H]1CCCC(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H33NO2/c1-13(2)9-7-11-15-12-8-10-14(3)18(15)16(19)20-17(4,5)6/h13-15H,7-12H2,1-6H3/t14?,15-/m0/s1 |
| InChIKey | XGZBCQIWMCMGKZ-LOACHALJSA-N |
| XLogP | 4.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |