C17H25NO3S — CID 104892458
tert-butyl 2-methyl-6-(2-oxo-2-thiophen-2-ylethyl)piperidine-1-carboxylate (PubChem CID 104892458) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is tert-butyl 2-methyl-6-(2-oxo-2-thiophen-2-ylethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-methyl-6-(2-oxo-2-thiophen-2-ylethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 104892458 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | tert-butyl 2-methyl-6-(2-oxo-2-thiophen-2-ylethyl)piperidine-1-carboxylate |
| SMILES | CC1CCCC(CC(=O)c2cccs2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25NO3S/c1-12-7-5-8-13(11-14(19)15-9-6-10-22-15)18(12)16(20)21-17(2,3)4/h6,9-10,12-13H,5,7-8,11H2,1-4H3 |
| InChIKey | SBRVXURGNMNTJR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |