C14H27NO2 — CID 10900787
tert-butyl (2R,6S)-2-methyl-6-propylpiperidine-1-carboxylate (PubChem CID 10900787) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is tert-butyl (2R,6S)-2-methyl-6-propylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,6S)-2-methyl-6-propylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 10900787 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | tert-butyl (2R,6S)-2-methyl-6-propylpiperidine-1-carboxylate |
| SMILES | CCC[C@H]1CCC[C@@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27NO2/c1-6-8-12-10-7-9-11(2)15(12)13(16)17-14(3,4)5/h11-12H,6-10H2,1-5H3/t11-,12+/m1/s1 |
| InChIKey | VUYCICJKIMXBKT-NEPJUHHUSA-N |
| XLogP | 3.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |