C14H19NO2 — CID 86338166
tert-butyl (5S,7S)-6-azatricyclo[5.3.0.01,5]deca-3,8-diene-6-carboxylate (PubChem CID 86338166) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is tert-butyl (5S,7S)-6-azatricyclo[5.3.0.01,5]deca-3,8-diene-6-carboxylate.
| Compound Name | tert-butyl (5S,7S)-6-azatricyclo[5.3.0.01,5]deca-3,8-diene-6-carboxylate |
|---|---|
| PubChem CID | 86338166 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | tert-butyl (5S,7S)-6-azatricyclo[5.3.0.01,5]deca-3,8-diene-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2C=CCC23CC=C[C@H]13 |
| InChI | InChI=1S/C14H19NO2/c1-13(2,3)17-12(16)15-10-6-4-8-14(10)9-5-7-11(14)15/h4-7,10-11H,8-9H2,1-3H3/t10-,11-,14?/m0/s1 |
| InChIKey | QONDMLQEWGSYFB-RFMBEDMFSA-N |
| XLogP | 2.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|