C18H30N2O4 — CID 23635831
ditert-butyl (1R,6S)-8,10-diazabicyclo[4.3.1]dec-3-ene-8,10-dicarboxylate (PubChem CID 23635831) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is ditert-butyl (1R,6S)-8,10-diazabicyclo[4.3.1]dec-3-ene-8,10-dicarboxylate.
| Compound Name | ditert-butyl (1R,6S)-8,10-diazabicyclo[4.3.1]dec-3-ene-8,10-dicarboxylate |
|---|---|
| PubChem CID | 23635831 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | ditert-butyl (1R,6S)-8,10-diazabicyclo[4.3.1]dec-3-ene-8,10-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC=CC[C@@H](C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30N2O4/c1-17(2,3)23-15(21)19-11-13-9-7-8-10-14(12-19)20(13)16(22)24-18(4,5)6/h7-8,13-14H,9-12H2,1-6H3/t13-,14+ |
| InChIKey | CSKOAWGHVMROJX-OKILXGFUSA-N |
| XLogP | 3.56 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|