C11H21NO2 — CID 143412058
tert-butyl 2,5-dihydropyrrole-1-carboxylate;ethane (PubChem CID 143412058) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is tert-butyl 2,5-dihydropyrrole-1-carboxylate;ethane.
| Compound Name | tert-butyl 2,5-dihydropyrrole-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143412058 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | tert-butyl 2,5-dihydropyrrole-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CC=CC1 |
| InChI | InChI=1S/C9H15NO2.C2H6/c1-9(2,3)12-8(11)10-6-4-5-7-10;1-2/h4-5H,6-7H2,1-3H3;1-2H3 |
| InChIKey | OMOWTZYSLBLTSE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|