C12H21NO3 — CID 102134519
tert-butyl (3R)-3-(hydroxymethyl)-2,3,4,7-tetrahydroazepine-1-carboxylate (PubChem CID 102134519) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl (3R)-3-(hydroxymethyl)-2,3,4,7-tetrahydroazepine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(hydroxymethyl)-2,3,4,7-tetrahydroazepine-1-carboxylate |
|---|---|
| PubChem CID | 102134519 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | tert-butyl (3R)-3-(hydroxymethyl)-2,3,4,7-tetrahydroazepine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=CC[C@@H](CO)C1 |
| InChI | InChI=1S/C12H21NO3/c1-12(2,3)16-11(15)13-7-5-4-6-10(8-13)9-14/h4-5,10,14H,6-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | HLHOMNMZBQTYSX-SNVBAGLBSA-N |
| XLogP | 1.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|