C9H19ClN2O2 — CID 45072199
tert-butyl 3-(aminomethyl)azetidine-1-carboxylate;hydrochloride (PubChem CID 45072199) has the molecular formula C9H19ClN2O2 and a molecular weight of 222.72 g/mol. Its IUPAC name is tert-butyl 3-(aminomethyl)azetidine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 3-(aminomethyl)azetidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 45072199 |
| Molecular Formula | C9H19ClN2O2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | tert-butyl 3-(aminomethyl)azetidine-1-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CC(CN)C1.Cl |
| InChI | InChI=1S/C9H18N2O2.ClH/c1-9(2,3)13-8(12)11-5-7(4-10)6-11;/h7H,4-6,10H2,1-3H3;1H |
| InChIKey | XJTMMJUCRQWXCE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |