About tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate
tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate (PubChem CID 11736302) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate.
Analyze tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate?
The IUPAC name of tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate (CID 11736302) is tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate?
The canonical SMILES for tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate is C[C@@H]1CC[C@@H](C)N(C(=O)OC(C)(C)C)C1=O.
What is the InChIKey of tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate?
The InChIKey is HBMGVXZPAMRMBX-RKDXNWHRSA-N. The full InChI is InChI=1S/C12H21NO3/c1-8-6-7-9(2)13(10(8)14)11(15)16-12(3,4)5/h8-9H,6-7H2,1-5H3/t8-,9-/m1/s1.
What are the key properties of tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate?
tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate has a molecular weight of 227.30 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3R,6R)-3,6-dimethyl-2-oxopiperidine-1-carboxylate is sourced from PubChem (CID 11736302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).