C25H24O4 — CID 102600196
tert-butyl (2R,3R)-2-hydroxy-3-naphthalen-1-yl-1-oxo-3,4-dihydronaphthalene-2-carboxylate (PubChem CID 102600196) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-hydroxy-3-naphthalen-1-yl-1-oxo-3,4-dihydronaphthalene-2-carboxylate.
| Compound Name | tert-butyl (2R,3R)-2-hydroxy-3-naphthalen-1-yl-1-oxo-3,4-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 102600196 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | tert-butyl (2R,3R)-2-hydroxy-3-naphthalen-1-yl-1-oxo-3,4-dihydronaphthalene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1(O)C(=O)c2ccccc2C[C@@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C25H24O4/c1-24(2,3)29-23(27)25(28)21(15-17-10-5-7-13-19(17)22(25)26)20-14-8-11-16-9-4-6-12-18(16)20/h4-14,21,28H,15H2,1-3H3/t21-,25-/m1/s1 |
| InChIKey | MEPCZEMQEHUXLD-PXDATVDWSA-N |
| XLogP | 4.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|