C14H18BrNO2 — CID 59505686
tert-butyl N-[(1R)-6-bromo-2,3-dihydro-1H-inden-1-yl]carbamate (PubChem CID 59505686) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is tert-butyl N-[(1R)-6-bromo-2,3-dihydro-1H-inden-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R)-6-bromo-2,3-dihydro-1H-inden-1-yl]carbamate |
|---|---|
| PubChem CID | 59505686 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | tert-butyl N-[(1R)-6-bromo-2,3-dihydro-1H-inden-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C14H18BrNO2/c1-14(2,3)18-13(17)16-12-7-5-9-4-6-10(15)8-11(9)12/h4,6,8,12H,5,7H2,1-3H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | YZEZLDIZHPBHGQ-GFCCVEGCSA-N |
| XLogP | 3.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |