C45H66N6O6 — CID 158735522
tert-butyl N-[(1R)-7-amino-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate;tert-butyl N-[(1S)-7-amino-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate;tert-butyl N-(7-amino-1,2,3,4-tetrahydronaphthalen-1-yl)carbamate (PubChem CID 158735522) has the molecular formula C45H66N6O6 and a molecular weight of 787.06 g/mol. Its IUPAC name is tert-butyl N-[(1R)-7-amino-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate;tert-butyl N-[(1S)-7-amino-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate;tert-butyl N-(7-amino-1,2,3,4-tetrahydronaphthalen-1-yl)carbamate.
| Compound Name | tert-butyl N-[(1R)-7-amino-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate;tert-butyl N-[(1S)-7-amino-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate;tert-butyl N-(7-amino-1,2,3,4-tetrahydronaphthalen-1-yl)carbamate |
|---|---|
| PubChem CID | 158735522 |
| Molecular Formula | C45H66N6O6 |
| Molecular Weight | 787.06 g/mol |
| Exact Mass | 786.50 |
| IUPAC Name | tert-butyl N-[(1R)-7-amino-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate;tert-butyl N-[(1S)-7-amino-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate;tert-butyl N-(7-amino-1,2,3,4-tetrahydronaphthalen-1-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCc2ccc(N)cc21.CC(C)(C)OC(=O)N[C@@H]1CCCc2ccc(N)cc21.CC(C)(C)OC(=O)N[C@H]1CCCc2ccc(N)cc21 |
| InChI | InChI=1S/3C15H22N2O2/c3*1-15(2,3)19-14(18)17-13-6-4-5-10-7-8-11(16)9-12(10)13/h3*7-9,13H,4-6,16H2,1-3H3,(H,17,18)/t2*13-;/m10./s1 |
| InChIKey | ILPZIHJBBZTDLQ-HAEKBSCCSA-N |
| XLogP | 9.51 |
| TPSA | 193.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.06 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|