C11H14N2O — CID 18627846
N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide (PubChem CID 18627846) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide.
| Compound Name | N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide |
|---|---|
| PubChem CID | 18627846 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide |
| SMILES | CC(=O)NC1CCc2ccc(N)cc21 |
| InChI | InChI=1S/C11H14N2O/c1-7(14)13-11-5-3-8-2-4-9(12)6-10(8)11/h2,4,6,11H,3,5,12H2,1H3,(H,13,14) |
| InChIKey | WIRJGMARAFJXHM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|