About N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide
N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide (PubChem CID 18627846) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide |
| PubChem CID | 18627846 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide |
| SMILES | CC(=O)NC1CCc2ccc(N)cc21 |
| InChI | InChI=1S/C11H14N2O/c1-7(14)13-11-5-3-8-2-4-9(12)6-10(8)11/h2,4,6,11H,3,5,12H2,1H3,(H,13,14) |
| InChIKey | WIRJGMARAFJXHM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide?
The IUPAC name of N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide (CID 18627846) is N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide.
What is the SMILES notation for N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide?
The canonical SMILES for N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide is CC(=O)NC1CCc2ccc(N)cc21.
What is the InChIKey of N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide?
The InChIKey is WIRJGMARAFJXHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-7(14)13-11-5-3-8-2-4-9(12)6-10(8)11/h2,4,6,11H,3,5,12H2,1H3,(H,13,14).
What are the key properties of N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide?
N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide has a molecular weight of 190.25 g/mol, XLogP of 1.39, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-2,3-dihydro-1H-inden-1-yl)acetamide is sourced from PubChem (CID 18627846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).