C19H24O3 — CID 135036034
tert-butyl (4bS,8aR)-10-oxo-5,6,7,8,8a,9-hexahydro-4bH-phenanthrene-9-carboxylate (PubChem CID 135036034) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is tert-butyl (4bS,8aR)-10-oxo-5,6,7,8,8a,9-hexahydro-4bH-phenanthrene-9-carboxylate.
| Compound Name | tert-butyl (4bS,8aR)-10-oxo-5,6,7,8,8a,9-hexahydro-4bH-phenanthrene-9-carboxylate |
|---|---|
| PubChem CID | 135036034 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | tert-butyl (4bS,8aR)-10-oxo-5,6,7,8,8a,9-hexahydro-4bH-phenanthrene-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C(=O)c2ccccc2[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C19H24O3/c1-19(2,3)22-18(21)16-14-10-6-4-8-12(14)13-9-5-7-11-15(13)17(16)20/h5,7,9,11-12,14,16H,4,6,8,10H2,1-3H3/t12-,14-,16?/m1/s1 |
| InChIKey | LNXXVOWNBJXROK-OJDRRSAWSA-N |
| XLogP | 4.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|