C19H22O4 — CID 177392528
tert-butyl (1R,9S,11R,13R)-2-oxo-15-oxatetracyclo[7.5.1.01,11.03,8]pentadeca-3,5,7-triene-13-carboxylate (PubChem CID 177392528) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is tert-butyl (1R,9S,11R,13R)-2-oxo-15-oxatetracyclo[7.5.1.01,11.03,8]pentadeca-3,5,7-triene-13-carboxylate.
| Compound Name | tert-butyl (1R,9S,11R,13R)-2-oxo-15-oxatetracyclo[7.5.1.01,11.03,8]pentadeca-3,5,7-triene-13-carboxylate |
|---|---|
| PubChem CID | 177392528 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | tert-butyl (1R,9S,11R,13R)-2-oxo-15-oxatetracyclo[7.5.1.01,11.03,8]pentadeca-3,5,7-triene-13-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H]2C[C@@H]3O[C@@]2(C1)C(=O)c1ccccc13 |
| InChI | InChI=1S/C19H22O4/c1-18(2,3)23-17(21)11-8-12-9-15-13-6-4-5-7-14(13)16(20)19(12,10-11)22-15/h4-7,11-12,15H,8-10H2,1-3H3/t11-,12-,15+,19-/m1/s1 |
| InChIKey | SPJTYAMALXNZLP-JFVXACQESA-N |
| XLogP | 3.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |