C17H22O2 — CID 117399697
1-(2-cyclohexylphenyl)cyclobutane-1-carboxylic acid (PubChem CID 117399697) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-(2-cyclohexylphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(2-cyclohexylphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117399697 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1-(2-cyclohexylphenyl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2C2CCCCC2)CCC1 |
| InChI | InChI=1S/C17H22O2/c18-16(19)17(11-6-12-17)15-10-5-4-9-14(15)13-7-2-1-3-8-13/h4-5,9-10,13H,1-3,6-8,11-12H2,(H,18,19) |
| InChIKey | LAVVKYRETJJVNU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |