C19H26O2 — CID 117462129
1-(4-cycloheptylphenyl)cyclopentane-1-carboxylic acid (PubChem CID 117462129) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is 1-(4-cycloheptylphenyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(4-cycloheptylphenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117462129 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 1-(4-cycloheptylphenyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc(C3CCCCCC3)cc2)CCCC1 |
| InChI | InChI=1S/C19H26O2/c20-18(21)19(13-5-6-14-19)17-11-9-16(10-12-17)15-7-3-1-2-4-8-15/h9-12,15H,1-8,13-14H2,(H,20,21) |
| InChIKey | BNHQTFFATLAPNI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |