C18H24O3 — CID 117466009
1-[2-(oxan-4-yl)phenyl]cyclohexane-1-carboxylic acid (PubChem CID 117466009) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-[2-(oxan-4-yl)phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[2-(oxan-4-yl)phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117466009 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-[2-(oxan-4-yl)phenyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2C2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C18H24O3/c19-17(20)18(10-4-1-5-11-18)16-7-3-2-6-15(16)14-8-12-21-13-9-14/h2-3,6-7,14H,1,4-5,8-13H2,(H,19,20) |
| InChIKey | GLLRYVIGYQOSPO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |