C12H14O2 — CID 130927469
(1R,8bR)-2,3,4,4a-tetrahydro-1H-biphenylene-1,8b-diol (PubChem CID 130927469) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (1R,8bR)-2,3,4,4a-tetrahydro-1H-biphenylene-1,8b-diol.
| Compound Name | (1R,8bR)-2,3,4,4a-tetrahydro-1H-biphenylene-1,8b-diol |
|---|---|
| PubChem CID | 130927469 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (1R,8bR)-2,3,4,4a-tetrahydro-1H-biphenylene-1,8b-diol |
| SMILES | O[C@@H]1CCCC2c3ccccc3[C@]21O |
| InChI | InChI=1S/C12H14O2/c13-11-7-3-6-10-8-4-1-2-5-9(8)12(10,11)14/h1-2,4-5,10-11,13-14H,3,6-7H2/t10?,11-,12+/m1/s1 |
| InChIKey | DHYZCLKAJRUSNH-SAIIYOCFSA-N |
| XLogP | 1.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |