C16H18O2 — CID 102094905
trans-(1R,2R)-1-naphthalen-1-ylcyclohexane-1,2-diol (PubChem CID 102094905) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is trans-(1R,2R)-1-naphthalen-1-ylcyclohexane-1,2-diol.
| Compound Name | trans-(1R,2R)-1-naphthalen-1-ylcyclohexane-1,2-diol |
|---|---|
| PubChem CID | 102094905 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | trans-(1R,2R)-1-naphthalen-1-ylcyclohexane-1,2-diol |
| SMILES | O[C@@H]1CCCC[C@@]1(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H18O2/c17-15-10-3-4-11-16(15,18)14-9-5-7-12-6-1-2-8-13(12)14/h1-2,5-9,15,17-18H,3-4,10-11H2/t15-,16-/m1/s1 |
| InChIKey | SYTOPOADCYYUKC-HZPDHXFCSA-N |
| XLogP | 2.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |