C13H16O — CID 7055569
(1S,8R)-tricyclo[6.5.0.02,7]trideca-2,4,6-trien-1-ol (PubChem CID 7055569) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (1S,8R)-tricyclo[6.5.0.02,7]trideca-2,4,6-trien-1-ol.
| Compound Name | (1S,8R)-tricyclo[6.5.0.02,7]trideca-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 7055569 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (1S,8R)-tricyclo[6.5.0.02,7]trideca-2,4,6-trien-1-ol |
| SMILES | O[C@@]12CCCCC[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C13H16O/c14-13-9-5-1-2-7-11(13)10-6-3-4-8-12(10)13/h3-4,6,8,11,14H,1-2,5,7,9H2/t11-,13+/m1/s1 |
| InChIKey | JMTSXWGSSWFYNM-YPMHNXCESA-N |
| XLogP | 2.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |