C16H21N — CID 59542372
(3aR,7aS,11bR)-11b-methyl-1,2,3,4,5,6,7,7a-octahydrofluoreno[9,8a-b]pyrrole (PubChem CID 59542372) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (3aR,7aS,11bR)-11b-methyl-1,2,3,4,5,6,7,7a-octahydrofluoreno[9,8a-b]pyrrole.
| Compound Name | (3aR,7aS,11bR)-11b-methyl-1,2,3,4,5,6,7,7a-octahydrofluoreno[9,8a-b]pyrrole |
|---|---|
| PubChem CID | 59542372 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (3aR,7aS,11bR)-11b-methyl-1,2,3,4,5,6,7,7a-octahydrofluoreno[9,8a-b]pyrrole |
| SMILES | C[C@@]12NCC[C@@]13CCCC[C@H]3c1ccccc12 |
| InChI | InChI=1S/C16H21N/c1-15-13-7-3-2-6-12(13)14-8-4-5-9-16(14,15)10-11-17-15/h2-3,6-7,14,17H,4-5,8-11H2,1H3/t14-,15-,16+/m0/s1 |
| InChIKey | VAZCEEJWFSESJQ-HRCADAONSA-N |
| XLogP | 3.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |