C14H17NO — CID 706828
(4aS,10bS)-4a-methyl-1,2,3,4,5,10b-hexahydrophenanthridin-6-one (PubChem CID 706828) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (4aS,10bS)-4a-methyl-1,2,3,4,5,10b-hexahydrophenanthridin-6-one.
| Compound Name | (4aS,10bS)-4a-methyl-1,2,3,4,5,10b-hexahydrophenanthridin-6-one |
|---|---|
| PubChem CID | 706828 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (4aS,10bS)-4a-methyl-1,2,3,4,5,10b-hexahydrophenanthridin-6-one |
| SMILES | C[C@]12CCCC[C@H]1c1ccccc1C(=O)N2 |
| InChI | InChI=1S/C14H17NO/c1-14-9-5-4-8-12(14)10-6-2-3-7-11(10)13(16)15-14/h2-3,6-7,12H,4-5,8-9H2,1H3,(H,15,16)/t12-,14-/m0/s1 |
| InChIKey | OILHGVNUGYSDRQ-JSGCOSHPSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |