About 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one
3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one (PubChem CID 171099763) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one |
| PubChem CID | 171099763 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NC(CC2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C14H17NO/c16-14-12-8-4-3-7-11(12)13(15-14)9-10-5-1-2-6-10/h3-4,7-8,10,13H,1-2,5-6,9H2,(H,15,16) |
| InChIKey | RBYIYBGYXSRRDC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one?
The IUPAC name of 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one (CID 171099763) is 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one?
The canonical SMILES for 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one is O=C1NC(CC2CCCC2)c2ccccc21.
What is the InChIKey of 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one?
The InChIKey is RBYIYBGYXSRRDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c16-14-12-8-4-3-7-11(12)13(15-14)9-10-5-1-2-6-10/h3-4,7-8,10,13H,1-2,5-6,9H2,(H,15,16).
What are the key properties of 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one?
3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one has a molecular weight of 215.30 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopentylmethyl)-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 171099763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).