C9H9NO2 — CID 119088605
3-(hydroxymethyl)-2,3-dihydroisoindol-1-one (PubChem CID 119088605) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-(hydroxymethyl)-2,3-dihydroisoindol-1-one.
| Compound Name | 3-(hydroxymethyl)-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 119088605 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 3-(hydroxymethyl)-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NC(CO)c2ccccc21 |
| InChI | InChI=1S/C9H9NO2/c11-5-8-6-3-1-2-4-7(6)9(12)10-8/h1-4,8,11H,5H2,(H,10,12) |
| InChIKey | DUEPZMALFZDUAN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |