C16H12ClNO2 — CID 164681172
(3S)-3-[2-(4-chlorophenyl)-2-oxoethyl]-2,3-dihydroisoindol-1-one (PubChem CID 164681172) has the molecular formula C16H12ClNO2 and a molecular weight of 285.73 g/mol. Its IUPAC name is (3S)-3-[2-(4-chlorophenyl)-2-oxoethyl]-2,3-dihydroisoindol-1-one.
| Compound Name | (3S)-3-[2-(4-chlorophenyl)-2-oxoethyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 164681172 |
| Molecular Formula | C16H12ClNO2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (3S)-3-[2-(4-chlorophenyl)-2-oxoethyl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C(C[C@@H]1NC(=O)c2ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12ClNO2/c17-11-7-5-10(6-8-11)15(19)9-14-12-3-1-2-4-13(12)16(20)18-14/h1-8,14H,9H2,(H,18,20)/t14-/m0/s1 |
| InChIKey | RHRNWAMJEBVNFV-AWEZNQCLSA-N |
| XLogP | 3.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |