C17H16N2O2 — CID 7678919
N-benzyl-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]acetamide (PubChem CID 7678919) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-benzyl-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]acetamide.
| Compound Name | N-benzyl-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]acetamide |
|---|---|
| PubChem CID | 7678919 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-benzyl-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]acetamide |
| SMILES | O=C(C[C@@H]1NC(=O)c2ccccc21)NCc1ccccc1 |
| InChI | InChI=1S/C17H16N2O2/c20-16(18-11-12-6-2-1-3-7-12)10-15-13-8-4-5-9-14(13)17(21)19-15/h1-9,15H,10-11H2,(H,18,20)(H,19,21)/t15-/m0/s1 |
| InChIKey | GJEGEWFKTZGQJZ-HNNXBMFYSA-N |
| XLogP | 2.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |