C15H13N3O2 — CID 96557176
2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]-N-pyridin-4-ylacetamide (PubChem CID 96557176) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]-N-pyridin-4-ylacetamide.
| Compound Name | 2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]-N-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 96557176 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]-N-pyridin-4-ylacetamide |
| SMILES | O=C(C[C@@H]1NC(=O)c2ccccc21)Nc1ccncc1 |
| InChI | InChI=1S/C15H13N3O2/c19-14(17-10-5-7-16-8-6-10)9-13-11-3-1-2-4-12(11)15(20)18-13/h1-8,13H,9H2,(H,18,20)(H,16,17,19)/t13-/m0/s1 |
| InChIKey | JWVDJXFVKSCIBW-ZDUSSCGKSA-N |
| XLogP | 1.89 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |