C20H21NO2 — CID 164681170
(3S)-3-[2-(4-tert-butylphenyl)-2-oxoethyl]-2,3-dihydroisoindol-1-one (PubChem CID 164681170) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3S)-3-[2-(4-tert-butylphenyl)-2-oxoethyl]-2,3-dihydroisoindol-1-one.
| Compound Name | (3S)-3-[2-(4-tert-butylphenyl)-2-oxoethyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 164681170 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3S)-3-[2-(4-tert-butylphenyl)-2-oxoethyl]-2,3-dihydroisoindol-1-one |
| SMILES | CC(C)(C)c1ccc(C(=O)C[C@@H]2NC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H21NO2/c1-20(2,3)14-10-8-13(9-11-14)18(22)12-17-15-6-4-5-7-16(15)19(23)21-17/h4-11,17H,12H2,1-3H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | HHONAELKAVZBSI-KRWDZBQOSA-N |
| XLogP | 4.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |