C10H12N2O2 — CID 13319457
3-(2-hydroxyethylamino)-2,3-dihydroisoindol-1-one (PubChem CID 13319457) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3-(2-hydroxyethylamino)-2,3-dihydroisoindol-1-one.
| Compound Name | 3-(2-hydroxyethylamino)-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 13319457 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3-(2-hydroxyethylamino)-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NC(NCCO)c2ccccc21 |
| InChI | InChI=1S/C10H12N2O2/c13-6-5-11-9-7-3-1-2-4-8(7)10(14)12-9/h1-4,9,11,13H,5-6H2,(H,12,14) |
| InChIKey | SKLKZIIFERPYQU-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |