C9H7NO2 — CID 153205873
2,7b-dihydro-1aH-oxireno[2,3-c]isoquinolin-3-one (PubChem CID 153205873) has the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. Its IUPAC name is 2,7b-dihydro-1aH-oxireno[2,3-c]isoquinolin-3-one.
| Compound Name | 2,7b-dihydro-1aH-oxireno[2,3-c]isoquinolin-3-one |
|---|---|
| PubChem CID | 153205873 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 2,7b-dihydro-1aH-oxireno[2,3-c]isoquinolin-3-one |
| SMILES | O=C1NC2OC2c2ccccc21 |
| InChI | InChI=1S/C9H7NO2/c11-8-6-4-2-1-3-5(6)7-9(10-8)12-7/h1-4,7,9H,(H,10,11) |
| InChIKey | WKURANDZNHUQEB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|