C15H16N2O3 — CID 138964072
(3aS,9bR)-2-tert-butyl-4,9b-dihydro-3aH-pyrrolo[3,4-c]isoquinoline-1,3,5-trione (PubChem CID 138964072) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is (3aS,9bR)-2-tert-butyl-4,9b-dihydro-3aH-pyrrolo[3,4-c]isoquinoline-1,3,5-trione.
| Compound Name | (3aS,9bR)-2-tert-butyl-4,9b-dihydro-3aH-pyrrolo[3,4-c]isoquinoline-1,3,5-trione |
|---|---|
| PubChem CID | 138964072 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (3aS,9bR)-2-tert-butyl-4,9b-dihydro-3aH-pyrrolo[3,4-c]isoquinoline-1,3,5-trione |
| SMILES | CC(C)(C)N1C(=O)[C@H]2NC(=O)c3ccccc3[C@H]2C1=O |
| InChI | InChI=1S/C15H16N2O3/c1-15(2,3)17-13(19)10-8-6-4-5-7-9(8)12(18)16-11(10)14(17)20/h4-7,10-11H,1-3H3,(H,16,18)/t10-,11+/m1/s1 |
| InChIKey | LKCIAFOYKGAZDI-MNOVXSKESA-N |
| XLogP | 1.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|