C13H15NO — CID 84733844
3-cyclopentyl-2,3-dihydroisoindol-1-one (PubChem CID 84733844) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-cyclopentyl-2,3-dihydroisoindol-1-one.
| Compound Name | 3-cyclopentyl-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 84733844 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 3-cyclopentyl-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NC(C2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C13H15NO/c15-13-11-8-4-3-7-10(11)12(14-13)9-5-1-2-6-9/h3-4,7-9,12H,1-2,5-6H2,(H,14,15) |
| InChIKey | ZACDUXJGJGMLLO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |