C11H13NO — CID 59874658
3,4-dimethyl-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 59874658) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 3,4-dimethyl-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 3,4-dimethyl-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 59874658 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3,4-dimethyl-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | CC1NC(=O)c2ccccc2C1C |
| InChI | InChI=1S/C11H13NO/c1-7-8(2)12-11(13)10-6-4-3-5-9(7)10/h3-8H,1-2H3,(H,12,13) |
| InChIKey | MWWQHQLDTCWYJN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |