C17H15NO2 — CID 102510066
(3S,4S)-3-methyl-4-phenyl-3,4-dihydro-2H-2-benzazepine-1,5-dione (PubChem CID 102510066) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is (3S,4S)-3-methyl-4-phenyl-3,4-dihydro-2H-2-benzazepine-1,5-dione.
| Compound Name | (3S,4S)-3-methyl-4-phenyl-3,4-dihydro-2H-2-benzazepine-1,5-dione |
|---|---|
| PubChem CID | 102510066 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (3S,4S)-3-methyl-4-phenyl-3,4-dihydro-2H-2-benzazepine-1,5-dione |
| SMILES | C[C@@H]1NC(=O)c2ccccc2C(=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H15NO2/c1-11-15(12-7-3-2-4-8-12)16(19)13-9-5-6-10-14(13)17(20)18-11/h2-11,15H,1H3,(H,18,20)/t11-,15+/m0/s1 |
| InChIKey | LWGHNLQWIVBZSF-XHDPSFHLSA-N |
| XLogP | 2.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |