C22H16O3 — CID 139635069
5-hydroxy-2,3-diphenyl-2,3-dihydronaphthalene-1,4-dione (PubChem CID 139635069) has the molecular formula C22H16O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 5-hydroxy-2,3-diphenyl-2,3-dihydronaphthalene-1,4-dione.
| Compound Name | 5-hydroxy-2,3-diphenyl-2,3-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 139635069 |
| Molecular Formula | C22H16O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-hydroxy-2,3-diphenyl-2,3-dihydronaphthalene-1,4-dione |
| SMILES | O=C1c2cccc(O)c2C(=O)C(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C22H16O3/c23-17-13-7-12-16-20(17)22(25)19(15-10-5-2-6-11-15)18(21(16)24)14-8-3-1-4-9-14/h1-13,18-19,23H |
| InChIKey | AZIXCNOHEWCHDA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|