C15H13NO — CID 15416039
(3S)-3-phenyl-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 15416039) has the molecular formula C15H13NO and a molecular weight of 223.28 g/mol. Its IUPAC name is (3S)-3-phenyl-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | (3S)-3-phenyl-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 15416039 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (3S)-3-phenyl-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1N[C@H](c2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C15H13NO/c17-15-13-9-5-4-8-12(13)10-14(16-15)11-6-2-1-3-7-11/h1-9,14H,10H2,(H,16,17)/t14-/m0/s1 |
| InChIKey | VMTGXGJJANYCDX-AWEZNQCLSA-N |
| XLogP | 2.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |