C22H19NO2 — CID 90836953
formaldehyde;3-(4-phenylphenyl)-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 90836953) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is formaldehyde;3-(4-phenylphenyl)-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | formaldehyde;3-(4-phenylphenyl)-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 90836953 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | formaldehyde;3-(4-phenylphenyl)-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | C=O.O=C1NC(c2ccc(-c3ccccc3)cc2)Cc2ccccc21 |
| InChI | InChI=1S/C21H17NO.CH2O/c23-21-19-9-5-4-8-18(19)14-20(22-21)17-12-10-16(11-13-17)15-6-2-1-3-7-15;1-2/h1-13,20H,14H2,(H,22,23);1H2 |
| InChIKey | AVMMEUHGKKGOCY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |