C14H12N2O — CID 132536769
2-phenyl-2,3-dihydro-1H-1,8-naphthyridin-4-one (PubChem CID 132536769) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-phenyl-2,3-dihydro-1H-1,8-naphthyridin-4-one.
| Compound Name | 2-phenyl-2,3-dihydro-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 132536769 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-phenyl-2,3-dihydro-1H-1,8-naphthyridin-4-one |
| SMILES | O=C1CC(c2ccccc2)Nc2ncccc21 |
| InChI | InChI=1S/C14H12N2O/c17-13-9-12(10-5-2-1-3-6-10)16-14-11(13)7-4-8-15-14/h1-8,12H,9H2,(H,15,16) |
| InChIKey | WHVLBFUYPXQCBB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |