C20H17N3O2 — CID 122182442
2-(3-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 122182442) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-(3-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(3-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 122182442 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-(3-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=C1NC(c2cccc(OCc3ccccc3)c2)Nc2ncccc21 |
| InChI | InChI=1S/C20H17N3O2/c24-20-17-10-5-11-21-19(17)22-18(23-20)15-8-4-9-16(12-15)25-13-14-6-2-1-3-7-14/h1-12,18H,13H2,(H,21,22)(H,23,24) |
| InChIKey | ZFTGCHAIVRZOJG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |