C25H22N2O3 — CID 2427856
(5R,6S)-5-benzoyl-4-methylidene-6-(3-phenylmethoxyphenyl)-1,3-diazinan-2-one (PubChem CID 2427856) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is (5R,6S)-5-benzoyl-4-methylidene-6-(3-phenylmethoxyphenyl)-1,3-diazinan-2-one.
| Compound Name | (5R,6S)-5-benzoyl-4-methylidene-6-(3-phenylmethoxyphenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 2427856 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (5R,6S)-5-benzoyl-4-methylidene-6-(3-phenylmethoxyphenyl)-1,3-diazinan-2-one |
| SMILES | C=C1NC(=O)N[C@H](c2cccc(OCc3ccccc3)c2)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O3/c1-17-22(24(28)19-11-6-3-7-12-19)23(27-25(29)26-17)20-13-8-14-21(15-20)30-16-18-9-4-2-5-10-18/h2-15,22-23H,1,16H2,(H2,26,27,29)/t22-,23+/m0/s1 |
| InChIKey | VZUNBIPXJZGNFJ-XZOQPEGZSA-N |
| XLogP | 4.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |