C19H18N2O2 — CID 2369403
(5R,6R)-5-benzoyl-4-methylidene-6-(3-methylphenyl)-1,3-diazinan-2-one (PubChem CID 2369403) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (5R,6R)-5-benzoyl-4-methylidene-6-(3-methylphenyl)-1,3-diazinan-2-one.
| Compound Name | (5R,6R)-5-benzoyl-4-methylidene-6-(3-methylphenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 2369403 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (5R,6R)-5-benzoyl-4-methylidene-6-(3-methylphenyl)-1,3-diazinan-2-one |
| SMILES | C=C1NC(=O)N[C@@H](c2cccc(C)c2)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O2/c1-12-7-6-10-15(11-12)17-16(13(2)20-19(23)21-17)18(22)14-8-4-3-5-9-14/h3-11,16-17H,2H2,1H3,(H2,20,21,23)/t16-,17-/m0/s1 |
| InChIKey | CWIXYKHETSRVBG-IRXDYDNUSA-N |
| XLogP | 3.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |