C18H15FN2O2 — CID 4093145
5-benzoyl-4-(3-fluorophenyl)-6-methylidene-1,3-diazinan-2-one (PubChem CID 4093145) has the molecular formula C18H15FN2O2 and a molecular weight of 310.33 g/mol. Its IUPAC name is 5-benzoyl-4-(3-fluorophenyl)-6-methylidene-1,3-diazinan-2-one.
| Compound Name | 5-benzoyl-4-(3-fluorophenyl)-6-methylidene-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 4093145 |
| Molecular Formula | C18H15FN2O2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-benzoyl-4-(3-fluorophenyl)-6-methylidene-1,3-diazinan-2-one |
| SMILES | C=C1NC(=O)NC(c2cccc(F)c2)C1C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15FN2O2/c1-11-15(17(22)12-6-3-2-4-7-12)16(21-18(23)20-11)13-8-5-9-14(19)10-13/h2-10,15-16H,1H2,(H2,20,21,23) |
| InChIKey | KJUWMRBOLWFASE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |