C20H20N2O2 — CID 2392471
(4S,5R)-5-benzoyl-4-(2,5-dimethylphenyl)-6-methylidene-1,3-diazinan-2-one (PubChem CID 2392471) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (4S,5R)-5-benzoyl-4-(2,5-dimethylphenyl)-6-methylidene-1,3-diazinan-2-one.
| Compound Name | (4S,5R)-5-benzoyl-4-(2,5-dimethylphenyl)-6-methylidene-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 2392471 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (4S,5R)-5-benzoyl-4-(2,5-dimethylphenyl)-6-methylidene-1,3-diazinan-2-one |
| SMILES | C=C1NC(=O)N[C@H](c2cc(C)ccc2C)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O2/c1-12-9-10-13(2)16(11-12)18-17(14(3)21-20(24)22-18)19(23)15-7-5-4-6-8-15/h4-11,17-18H,3H2,1-2H3,(H2,21,22,24)/t17-,18+/m0/s1 |
| InChIKey | GWFHUBXNSPHPGF-ZWKOTPCHSA-N |
| XLogP | 3.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |