C20H12N4O — CID 3350776
3-(3-phenylmethoxyphenyl)cyclopropane-1,1,2,2-tetracarbonitrile (PubChem CID 3350776) has the molecular formula C20H12N4O and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-(3-phenylmethoxyphenyl)cyclopropane-1,1,2,2-tetracarbonitrile.
| Compound Name | 3-(3-phenylmethoxyphenyl)cyclopropane-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 3350776 |
| Molecular Formula | C20H12N4O |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 3-(3-phenylmethoxyphenyl)cyclopropane-1,1,2,2-tetracarbonitrile |
| SMILES | N#CC1(C#N)C(c2cccc(OCc3ccccc3)c2)C1(C#N)C#N |
| InChI | InChI=1S/C20H12N4O/c21-11-19(12-22)18(20(19,13-23)14-24)16-7-4-8-17(9-16)25-10-15-5-2-1-3-6-15/h1-9,18H,10H2 |
| InChIKey | KLOICNQFEYDGHY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|